C16H21NO2 — CID 44553946
(4aS,10aS)-9-methoxy-4-prop-2-enyl-2,3,4a,5,10,10a-hexahydrobenzo[g][1,4]benzoxazine (PubChem CID 44553946) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is (4aS,10aS)-9-methoxy-4-prop-2-enyl-2,3,4a,5,10,10a-hexahydrobenzo[g][1,4]benzoxazine.
| Compound Name | (4aS,10aS)-9-methoxy-4-prop-2-enyl-2,3,4a,5,10,10a-hexahydrobenzo[g][1,4]benzoxazine |
|---|---|
| PubChem CID | 44553946 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | (4aS,10aS)-9-methoxy-4-prop-2-enyl-2,3,4a,5,10,10a-hexahydrobenzo[g][1,4]benzoxazine |
| SMILES | C=CCN1CCO[C@H]2Cc3c(cccc3OC)C[C@@H]21 |
| InChI | InChI=1S/C16H21NO2/c1-3-7-17-8-9-19-16-11-13-12(10-14(16)17)5-4-6-15(13)18-2/h3-6,14,16H,1,7-11H2,2H3/t14-,16-/m0/s1 |
| InChIKey | FCSAJQZOVHDVIA-HOCLYGCPSA-N |
| XLogP | 2.05 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|