C13H18ClNO2 — CID 67005538
(4aS,10aS)-9-methoxy-3,4,4a,5,10,10a-hexahydro-2H-benzo[g][1,4]benzoxazine;hydrochloride (PubChem CID 67005538) has the molecular formula C13H18ClNO2 and a molecular weight of 255.74 g/mol. Its IUPAC name is (4aS,10aS)-9-methoxy-3,4,4a,5,10,10a-hexahydro-2H-benzo[g][1,4]benzoxazine;hydrochloride.
| Compound Name | (4aS,10aS)-9-methoxy-3,4,4a,5,10,10a-hexahydro-2H-benzo[g][1,4]benzoxazine;hydrochloride |
|---|---|
| PubChem CID | 67005538 |
| Molecular Formula | C13H18ClNO2 |
| Molecular Weight | 255.74 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | (4aS,10aS)-9-methoxy-3,4,4a,5,10,10a-hexahydro-2H-benzo[g][1,4]benzoxazine;hydrochloride |
| SMILES | COc1cccc2c1C[C@@H]1OCCN[C@H]1C2.Cl |
| InChI | InChI=1S/C13H17NO2.ClH/c1-15-12-4-2-3-9-7-11-13(8-10(9)12)16-6-5-14-11;/h2-4,11,13-14H,5-8H2,1H3;1H/t11-,13-;/m0./s1 |
| InChIKey | ZQTHANLZOFEYES-JZKFLRDJSA-N |
| XLogP | 1.57 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.74 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |