C16H25NO3 — CID 143917280
[(10aR)-9-methoxy-3,4,4a,5,10,10a-hexahydro-2H-benzo[g][1,4]benzoxazin-2-yl]methanol;ethane (PubChem CID 143917280) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is [(10aR)-9-methoxy-3,4,4a,5,10,10a-hexahydro-2H-benzo[g][1,4]benzoxazin-2-yl]methanol;ethane.
| Compound Name | [(10aR)-9-methoxy-3,4,4a,5,10,10a-hexahydro-2H-benzo[g][1,4]benzoxazin-2-yl]methanol;ethane |
|---|---|
| PubChem CID | 143917280 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | [(10aR)-9-methoxy-3,4,4a,5,10,10a-hexahydro-2H-benzo[g][1,4]benzoxazin-2-yl]methanol;ethane |
| SMILES | CC.COc1cccc2c1C[C@H]1OC(CO)CNC1C2 |
| InChI | InChI=1S/C14H19NO3.C2H6/c1-17-13-4-2-3-9-5-12-14(6-11(9)13)18-10(8-16)7-15-12;1-2/h2-4,10,12,14-16H,5-8H2,1H3;1-2H3/t10?,12?,14-;/m1./s1 |
| InChIKey | FXVRDGCRUVZHAY-XSQZMJFISA-N |
| XLogP | 1.54 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |