C10H13NO2 — CID 130665549
[(2S)-4-methoxy-2,3-dihydro-1H-indol-2-yl]methanol (PubChem CID 130665549) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is [(2S)-4-methoxy-2,3-dihydro-1H-indol-2-yl]methanol.
| Compound Name | [(2S)-4-methoxy-2,3-dihydro-1H-indol-2-yl]methanol |
|---|---|
| PubChem CID | 130665549 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | [(2S)-4-methoxy-2,3-dihydro-1H-indol-2-yl]methanol |
| SMILES | COc1cccc2c1C[C@@H](CO)N2 |
| InChI | InChI=1S/C10H13NO2/c1-13-10-4-2-3-9-8(10)5-7(6-12)11-9/h2-4,7,11-12H,5-6H2,1H3/t7-/m0/s1 |
| InChIKey | FXMHXEXGMCPRPQ-ZETCQYMHSA-N |
| XLogP | 1.02 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |