About [(3R)-5-methoxy-3,4-dihydro-2H-chromen-3-yl]methanol
[(3R)-5-methoxy-3,4-dihydro-2H-chromen-3-yl]methanol (PubChem CID 130660382) has the molecular formula C11H14O3
and a molecular weight of 194.23 g/mol. Its IUPAC name is [(3R)-5-methoxy-3,4-dihydro-2H-chromen-3-yl]methanol.
Molecular Properties
| Compound Name | [(3R)-5-methoxy-3,4-dihydro-2H-chromen-3-yl]methanol |
| PubChem CID | 130660382 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | [(3R)-5-methoxy-3,4-dihydro-2H-chromen-3-yl]methanol |
| SMILES | COc1cccc2c1C[C@H](CO)CO2 |
| InChI | InChI=1S/C11H14O3/c1-13-10-3-2-4-11-9(10)5-8(6-12)7-14-11/h2-4,8,12H,5-7H2,1H3/t8-/m1/s1 |
| InChIKey | LLTFQWFWQMCIOW-MRVPVSSYSA-N |
| XLogP | 1.24 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(3R)-5-methoxy-3,4-dihydro-2H-chromen-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-5-methoxy-3,4-dihydro-2H-chromen-3-yl]methanol?
The IUPAC name of [(3R)-5-methoxy-3,4-dihydro-2H-chromen-3-yl]methanol (CID 130660382) is [(3R)-5-methoxy-3,4-dihydro-2H-chromen-3-yl]methanol.
What is the SMILES notation for [(3R)-5-methoxy-3,4-dihydro-2H-chromen-3-yl]methanol?
The canonical SMILES for [(3R)-5-methoxy-3,4-dihydro-2H-chromen-3-yl]methanol is COc1cccc2c1C[C@H](CO)CO2.
What is the InChIKey of [(3R)-5-methoxy-3,4-dihydro-2H-chromen-3-yl]methanol?
The InChIKey is LLTFQWFWQMCIOW-MRVPVSSYSA-N. The full InChI is InChI=1S/C11H14O3/c1-13-10-3-2-4-11-9(10)5-8(6-12)7-14-11/h2-4,8,12H,5-7H2,1H3/t8-/m1/s1.
What are the key properties of [(3R)-5-methoxy-3,4-dihydro-2H-chromen-3-yl]methanol?
[(3R)-5-methoxy-3,4-dihydro-2H-chromen-3-yl]methanol has a molecular weight of 194.23 g/mol, XLogP of 1.24, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-5-methoxy-3,4-dihydro-2H-chromen-3-yl]methanol is sourced from PubChem (CID 130660382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).