About (3S)-N,N-dibenzyl-5-methoxy-3,4-dihydro-2H-chromen-3-amine;hydrochloride
(3S)-N,N-dibenzyl-5-methoxy-3,4-dihydro-2H-chromen-3-amine;hydrochloride (PubChem CID 18739701) has the molecular formula C24H26ClNO2
and a molecular weight of 395.93 g/mol. Its IUPAC name is (3S)-N,N-dibenzyl-5-methoxy-3,4-dihydro-2H-chromen-3-amine;hydrochloride.
Molecular Properties
| Compound Name | (3S)-N,N-dibenzyl-5-methoxy-3,4-dihydro-2H-chromen-3-amine;hydrochloride |
| PubChem CID | 18739701 |
| Molecular Formula | C24H26ClNO2 |
| Molecular Weight | 395.93 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | (3S)-N,N-dibenzyl-5-methoxy-3,4-dihydro-2H-chromen-3-amine;hydrochloride |
| SMILES | COc1cccc2c1C[C@H](N(Cc1ccccc1)Cc1ccccc1)CO2.Cl |
| InChI | InChI=1S/C24H25NO2.ClH/c1-26-23-13-8-14-24-22(23)15-21(18-27-24)25(16-19-9-4-2-5-10-19)17-20-11-6-3-7-12-20;/h2-14,21H,15-18H2,1H3;1H/t21-;/m0./s1 |
| InChIKey | FXZFFWKDEJQJEJ-BOXHHOBZSA-N |
| XLogP | 5.12 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.93 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-N,N-dibenzyl-5-methoxy-3,4-dihydro-2H-chromen-3-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-N,N-dibenzyl-5-methoxy-3,4-dihydro-2H-chromen-3-amine;hydrochloride?
The IUPAC name of (3S)-N,N-dibenzyl-5-methoxy-3,4-dihydro-2H-chromen-3-amine;hydrochloride (CID 18739701) is (3S)-N,N-dibenzyl-5-methoxy-3,4-dihydro-2H-chromen-3-amine;hydrochloride.
What is the SMILES notation for (3S)-N,N-dibenzyl-5-methoxy-3,4-dihydro-2H-chromen-3-amine;hydrochloride?
The canonical SMILES for (3S)-N,N-dibenzyl-5-methoxy-3,4-dihydro-2H-chromen-3-amine;hydrochloride is COc1cccc2c1C[C@H](N(Cc1ccccc1)Cc1ccccc1)CO2.Cl.
What is the InChIKey of (3S)-N,N-dibenzyl-5-methoxy-3,4-dihydro-2H-chromen-3-amine;hydrochloride?
The InChIKey is FXZFFWKDEJQJEJ-BOXHHOBZSA-N. The full InChI is InChI=1S/C24H25NO2.ClH/c1-26-23-13-8-14-24-22(23)15-21(18-27-24)25(16-19-9-4-2-5-10-19)17-20-11-6-3-7-12-20;/h2-14,21H,15-18H2,1H3;1H/t21-;/m0./s1.
What are the key properties of (3S)-N,N-dibenzyl-5-methoxy-3,4-dihydro-2H-chromen-3-amine;hydrochloride?
(3S)-N,N-dibenzyl-5-methoxy-3,4-dihydro-2H-chromen-3-amine;hydrochloride has a molecular weight of 395.93 g/mol, XLogP of 5.12, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-N,N-dibenzyl-5-methoxy-3,4-dihydro-2H-chromen-3-amine;hydrochloride is sourced from PubChem (CID 18739701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).