C13H19NO — CID 117193828
5-methoxy-2,2,3-trimethyl-3,4-dihydro-1H-quinoline (PubChem CID 117193828) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is 5-methoxy-2,2,3-trimethyl-3,4-dihydro-1H-quinoline.
| Compound Name | 5-methoxy-2,2,3-trimethyl-3,4-dihydro-1H-quinoline |
|---|---|
| PubChem CID | 117193828 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 5-methoxy-2,2,3-trimethyl-3,4-dihydro-1H-quinoline |
| SMILES | COc1cccc2c1CC(C)C(C)(C)N2 |
| InChI | InChI=1S/C13H19NO/c1-9-8-10-11(14-13(9,2)3)6-5-7-12(10)15-4/h5-7,9,14H,8H2,1-4H3 |
| InChIKey | FJBLZJYUDQFIRJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |