C9H9NO2S — CID 84773577
5-methoxy-1,4-dihydro-3,1-benzoxazine-2-thione (PubChem CID 84773577) has the molecular formula C9H9NO2S and a molecular weight of 195.24 g/mol. Its IUPAC name is 5-methoxy-1,4-dihydro-3,1-benzoxazine-2-thione.
| Compound Name | 5-methoxy-1,4-dihydro-3,1-benzoxazine-2-thione |
|---|---|
| PubChem CID | 84773577 |
| Molecular Formula | C9H9NO2S |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.04 |
| IUPAC Name | 5-methoxy-1,4-dihydro-3,1-benzoxazine-2-thione |
| SMILES | COc1cccc2c1COC(=S)N2 |
| InChI | InChI=1S/C9H9NO2S/c1-11-8-4-2-3-7-6(8)5-12-9(13)10-7/h2-4H,5H2,1H3,(H,10,13) |
| InChIKey | NNHDKRSQUNFZOB-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|