C10H14N2O — CID 115015195
6-methoxy-2,3,4,5-tetrahydro-1H-1,4-benzodiazepine (PubChem CID 115015195) has the molecular formula C10H14N2O and a molecular weight of 178.24 g/mol. Its IUPAC name is 6-methoxy-2,3,4,5-tetrahydro-1H-1,4-benzodiazepine.
| Compound Name | 6-methoxy-2,3,4,5-tetrahydro-1H-1,4-benzodiazepine |
|---|---|
| PubChem CID | 115015195 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 6-methoxy-2,3,4,5-tetrahydro-1H-1,4-benzodiazepine |
| SMILES | COc1cccc2c1CNCCN2 |
| InChI | InChI=1S/C10H14N2O/c1-13-10-4-2-3-9-8(10)7-11-5-6-12-9/h2-4,11-12H,5-7H2,1H3 |
| InChIKey | FVHHHEBUENIDSS-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |