C11H16N2O — CID 83818191
9-ethoxy-2,3,4,5-tetrahydro-1H-1,4-benzodiazepine (PubChem CID 83818191) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 9-ethoxy-2,3,4,5-tetrahydro-1H-1,4-benzodiazepine.
| Compound Name | 9-ethoxy-2,3,4,5-tetrahydro-1H-1,4-benzodiazepine |
|---|---|
| PubChem CID | 83818191 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 9-ethoxy-2,3,4,5-tetrahydro-1H-1,4-benzodiazepine |
| SMILES | CCOc1cccc2c1NCCNC2 |
| InChI | InChI=1S/C11H16N2O/c1-2-14-10-5-3-4-9-8-12-6-7-13-11(9)10/h3-5,12-13H,2,6-8H2,1H3 |
| InChIKey | OFMAXJYVLLODJX-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |