C12H17NOS — CID 105356216
5-ethoxy-2-ethyl-3,4-dihydro-2H-1,4-benzothiazine (PubChem CID 105356216) has the molecular formula C12H17NOS and a molecular weight of 223.34 g/mol. Its IUPAC name is 5-ethoxy-2-ethyl-3,4-dihydro-2H-1,4-benzothiazine.
| Compound Name | 5-ethoxy-2-ethyl-3,4-dihydro-2H-1,4-benzothiazine |
|---|---|
| PubChem CID | 105356216 |
| Molecular Formula | C12H17NOS |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 5-ethoxy-2-ethyl-3,4-dihydro-2H-1,4-benzothiazine |
| SMILES | CCOc1cccc2c1NCC(CC)S2 |
| InChI | InChI=1S/C12H17NOS/c1-3-9-8-13-12-10(14-4-2)6-5-7-11(12)15-9/h5-7,9,13H,3-4,8H2,1-2H3 |
| InChIKey | YDUPWZKDHKHVCN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |