C16H25NO2 — CID 63386466
5,8-diethoxy-3-propyl-1,2,3,4-tetrahydroquinoline (PubChem CID 63386466) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is 5,8-diethoxy-3-propyl-1,2,3,4-tetrahydroquinoline.
| Compound Name | 5,8-diethoxy-3-propyl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 63386466 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | 5,8-diethoxy-3-propyl-1,2,3,4-tetrahydroquinoline |
| SMILES | CCCC1CNc2c(OCC)ccc(OCC)c2C1 |
| InChI | InChI=1S/C16H25NO2/c1-4-7-12-10-13-14(18-5-2)8-9-15(19-6-3)16(13)17-11-12/h8-9,12,17H,4-7,10-11H2,1-3H3 |
| InChIKey | CBWZCHDNCCKBOB-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |