C14H20N2O — CID 113393246
4-ethoxy-6,6a,7,8,9,10-hexahydro-5H-pyrido[1,2-a]quinoxaline (PubChem CID 113393246) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 4-ethoxy-6,6a,7,8,9,10-hexahydro-5H-pyrido[1,2-a]quinoxaline.
| Compound Name | 4-ethoxy-6,6a,7,8,9,10-hexahydro-5H-pyrido[1,2-a]quinoxaline |
|---|---|
| PubChem CID | 113393246 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 4-ethoxy-6,6a,7,8,9,10-hexahydro-5H-pyrido[1,2-a]quinoxaline |
| SMILES | CCOc1cccc2c1NCC1CCCCN21 |
| InChI | InChI=1S/C14H20N2O/c1-2-17-13-8-5-7-12-14(13)15-10-11-6-3-4-9-16(11)12/h5,7-8,11,15H,2-4,6,9-10H2,1H3 |
| InChIKey | IKWXLDCYCHVRHF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |