C16H24N2O — CID 124675917
(4aS,8aS)-4-(2-ethoxyphenyl)-2,3,4a,5,6,7,8,8a-octahydro-1H-quinoxaline (PubChem CID 124675917) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is (4aS,8aS)-4-(2-ethoxyphenyl)-2,3,4a,5,6,7,8,8a-octahydro-1H-quinoxaline.
| Compound Name | (4aS,8aS)-4-(2-ethoxyphenyl)-2,3,4a,5,6,7,8,8a-octahydro-1H-quinoxaline |
|---|---|
| PubChem CID | 124675917 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | (4aS,8aS)-4-(2-ethoxyphenyl)-2,3,4a,5,6,7,8,8a-octahydro-1H-quinoxaline |
| SMILES | CCOc1ccccc1N1CCN[C@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C16H24N2O/c1-2-19-16-10-6-5-9-15(16)18-12-11-17-13-7-3-4-8-14(13)18/h5-6,9-10,13-14,17H,2-4,7-8,11-12H2,1H3/t13-,14-/m0/s1 |
| InChIKey | ZAYGWVLLACKDBC-KBPBESRZSA-N |
| XLogP | 2.81 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |