C15H24N2O — CID 54973542
1-(2-ethoxyphenyl)-4-methyl-1,5-diazocane (PubChem CID 54973542) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is 1-(2-ethoxyphenyl)-4-methyl-1,5-diazocane.
| Compound Name | 1-(2-ethoxyphenyl)-4-methyl-1,5-diazocane |
|---|---|
| PubChem CID | 54973542 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 1-(2-ethoxyphenyl)-4-methyl-1,5-diazocane |
| SMILES | CCOc1ccccc1N1CCCNC(C)CC1 |
| InChI | InChI=1S/C15H24N2O/c1-3-18-15-8-5-4-7-14(15)17-11-6-10-16-13(2)9-12-17/h4-5,7-8,13,16H,3,6,9-12H2,1-2H3 |
| InChIKey | RQIGWQWHPVALSG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |