C13H19ClN2 — CID 117014582
1-(2-chlorophenyl)-4-methyl-1,5-diazocane (PubChem CID 117014582) has the molecular formula C13H19ClN2 and a molecular weight of 238.76 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-4-methyl-1,5-diazocane.
| Compound Name | 1-(2-chlorophenyl)-4-methyl-1,5-diazocane |
|---|---|
| PubChem CID | 117014582 |
| Molecular Formula | C13H19ClN2 |
| Molecular Weight | 238.76 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 1-(2-chlorophenyl)-4-methyl-1,5-diazocane |
| SMILES | CC1CCN(c2ccccc2Cl)CCCN1 |
| InChI | InChI=1S/C13H19ClN2/c1-11-7-10-16(9-4-8-15-11)13-6-3-2-5-12(13)14/h2-3,5-6,11,15H,4,7-10H2,1H3 |
| InChIKey | MYSVYNDARYGPQF-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.76 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |