C16H26N2O2 — CID 65181009
1-[2-(3-ethoxypropoxy)phenyl]-1,4-diazepane (PubChem CID 65181009) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 1-[2-(3-ethoxypropoxy)phenyl]-1,4-diazepane.
| Compound Name | 1-[2-(3-ethoxypropoxy)phenyl]-1,4-diazepane |
|---|---|
| PubChem CID | 65181009 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 1-[2-(3-ethoxypropoxy)phenyl]-1,4-diazepane |
| SMILES | CCOCCCOc1ccccc1N1CCCNCC1 |
| InChI | InChI=1S/C16H26N2O2/c1-2-19-13-6-14-20-16-8-4-3-7-15(16)18-11-5-9-17-10-12-18/h3-4,7-8,17H,2,5-6,9-14H2,1H3 |
| InChIKey | YYDRHLBURLAKCQ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|