C15H23NO2 — CID 12585905
1-(2,6-diethoxyphenyl)piperidine (PubChem CID 12585905) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is 1-(2,6-diethoxyphenyl)piperidine.
| Compound Name | 1-(2,6-diethoxyphenyl)piperidine |
|---|---|
| PubChem CID | 12585905 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 1-(2,6-diethoxyphenyl)piperidine |
| SMILES | CCOc1cccc(OCC)c1N1CCCCC1 |
| InChI | InChI=1S/C15H23NO2/c1-3-17-13-9-8-10-14(18-4-2)15(13)16-11-6-5-7-12-16/h8-10H,3-7,11-12H2,1-2H3 |
| InChIKey | KJGGNMCMKKKZLV-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |