C14H17NO2 — CID 141150995
1-(2,6-diethoxyphenyl)pyrrole (PubChem CID 141150995) has the molecular formula C14H17NO2 and a molecular weight of 231.29 g/mol. Its IUPAC name is 1-(2,6-diethoxyphenyl)pyrrole.
| Compound Name | 1-(2,6-diethoxyphenyl)pyrrole |
|---|---|
| PubChem CID | 141150995 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | 1-(2,6-diethoxyphenyl)pyrrole |
| SMILES | CCOc1cccc(OCC)c1-n1cccc1 |
| InChI | InChI=1S/C14H17NO2/c1-3-16-12-8-7-9-13(17-4-2)14(12)15-10-5-6-11-15/h5-11H,3-4H2,1-2H3 |
| InChIKey | YKMVRAGHGBHJHM-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |