C15H24N2O — CID 93489676
(2R)-2-(2-ethoxyphenyl)-2-piperidin-1-ylethanamine (PubChem CID 93489676) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is (2R)-2-(2-ethoxyphenyl)-2-piperidin-1-ylethanamine.
| Compound Name | (2R)-2-(2-ethoxyphenyl)-2-piperidin-1-ylethanamine |
|---|---|
| PubChem CID | 93489676 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | (2R)-2-(2-ethoxyphenyl)-2-piperidin-1-ylethanamine |
| SMILES | CCOc1ccccc1[C@H](CN)N1CCCCC1 |
| InChI | InChI=1S/C15H24N2O/c1-2-18-15-9-5-4-8-13(15)14(12-16)17-10-6-3-7-11-17/h4-5,8-9,14H,2-3,6-7,10-12,16H2,1H3/t14-/m0/s1 |
| InChIKey | LOXXZSDJVWKOOL-AWEZNQCLSA-N |
| XLogP | 2.57 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |