About ethoxyethane;1-phenylpiperidine
ethoxyethane;1-phenylpiperidine (PubChem CID 174883082) has the molecular formula C15H25NO
and a molecular weight of 235.37 g/mol. Its IUPAC name is ethoxyethane;1-phenylpiperidine.
Molecular Properties
| Compound Name | ethoxyethane;1-phenylpiperidine |
| PubChem CID | 174883082 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | ethoxyethane;1-phenylpiperidine |
| SMILES | CCOCC.c1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C11H15N.C4H10O/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-3-5-4-2/h1,3-4,7-8H,2,5-6,9-10H2;3-4H2,1-2H3 |
| InChIKey | KRBIBXWGMMAACR-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethoxyethane;1-phenylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxyethane;1-phenylpiperidine?
The IUPAC name of ethoxyethane;1-phenylpiperidine (CID 174883082) is ethoxyethane;1-phenylpiperidine.
What is the SMILES notation for ethoxyethane;1-phenylpiperidine?
The canonical SMILES for ethoxyethane;1-phenylpiperidine is CCOCC.c1ccc(N2CCCCC2)cc1.
What is the InChIKey of ethoxyethane;1-phenylpiperidine?
The InChIKey is KRBIBXWGMMAACR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N.C4H10O/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-3-5-4-2/h1,3-4,7-8H,2,5-6,9-10H2;3-4H2,1-2H3.
What are the key properties of ethoxyethane;1-phenylpiperidine?
ethoxyethane;1-phenylpiperidine has a molecular weight of 235.37 g/mol, XLogP of 3.72, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxyethane;1-phenylpiperidine is sourced from PubChem (CID 174883082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).