C12H15BrN2 — CID 84640424
4-bromo-6,6a,7,8,9,10-hexahydro-5H-pyrido[1,2-a]quinoxaline (PubChem CID 84640424) has the molecular formula C12H15BrN2 and a molecular weight of 267.17 g/mol. Its IUPAC name is 4-bromo-6,6a,7,8,9,10-hexahydro-5H-pyrido[1,2-a]quinoxaline.
| Compound Name | 4-bromo-6,6a,7,8,9,10-hexahydro-5H-pyrido[1,2-a]quinoxaline |
|---|---|
| PubChem CID | 84640424 |
| Molecular Formula | C12H15BrN2 |
| Molecular Weight | 267.17 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 4-bromo-6,6a,7,8,9,10-hexahydro-5H-pyrido[1,2-a]quinoxaline |
| SMILES | Brc1cccc2c1NCC1CCCCN21 |
| InChI | InChI=1S/C12H15BrN2/c13-10-5-3-6-11-12(10)14-8-9-4-1-2-7-15(9)11/h3,5-6,9,14H,1-2,4,7-8H2 |
| InChIKey | AOKBGWOQNUJLSB-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.17 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |