C9H11BrN2 — CID 83839922
8-bromo-4-methyl-2,3-dihydro-1H-quinoxaline (PubChem CID 83839922) has the molecular formula C9H11BrN2 and a molecular weight of 227.10 g/mol. Its IUPAC name is 8-bromo-4-methyl-2,3-dihydro-1H-quinoxaline.
| Compound Name | 8-bromo-4-methyl-2,3-dihydro-1H-quinoxaline |
|---|---|
| PubChem CID | 83839922 |
| Molecular Formula | C9H11BrN2 |
| Molecular Weight | 227.10 g/mol |
| Exact Mass | 226.01 |
| IUPAC Name | 8-bromo-4-methyl-2,3-dihydro-1H-quinoxaline |
| SMILES | CN1CCNc2c(Br)cccc21 |
| InChI | InChI=1S/C9H11BrN2/c1-12-6-5-11-9-7(10)3-2-4-8(9)12/h2-4,11H,5-6H2,1H3 |
| InChIKey | AHMZYUYJDFANER-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.10 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |