About 6-bromo-1-methyl-3,5-dihydro-2H-1,5-benzodiazepin-4-one
6-bromo-1-methyl-3,5-dihydro-2H-1,5-benzodiazepin-4-one (PubChem CID 115098413) has the molecular formula C10H11BrN2O
and a molecular weight of 255.11 g/mol. Its IUPAC name is 6-bromo-1-methyl-3,5-dihydro-2H-1,5-benzodiazepin-4-one.
Molecular Properties
| Compound Name | 6-bromo-1-methyl-3,5-dihydro-2H-1,5-benzodiazepin-4-one |
| PubChem CID | 115098413 |
| Molecular Formula | C10H11BrN2O |
| Molecular Weight | 255.11 g/mol |
| Exact Mass | 254.01 |
| IUPAC Name | 6-bromo-1-methyl-3,5-dihydro-2H-1,5-benzodiazepin-4-one |
| SMILES | CN1CCC(=O)Nc2c(Br)cccc21 |
| InChI | InChI=1S/C10H11BrN2O/c1-13-6-5-9(14)12-10-7(11)3-2-4-8(10)13/h2-4H,5-6H2,1H3,(H,12,14) |
| InChIKey | OHULKJBAQAYUFT-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.11 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-bromo-1-methyl-3,5-dihydro-2H-1,5-benzodiazepin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-1-methyl-3,5-dihydro-2H-1,5-benzodiazepin-4-one?
The IUPAC name of 6-bromo-1-methyl-3,5-dihydro-2H-1,5-benzodiazepin-4-one (CID 115098413) is 6-bromo-1-methyl-3,5-dihydro-2H-1,5-benzodiazepin-4-one.
What is the SMILES notation for 6-bromo-1-methyl-3,5-dihydro-2H-1,5-benzodiazepin-4-one?
The canonical SMILES for 6-bromo-1-methyl-3,5-dihydro-2H-1,5-benzodiazepin-4-one is CN1CCC(=O)Nc2c(Br)cccc21.
What is the InChIKey of 6-bromo-1-methyl-3,5-dihydro-2H-1,5-benzodiazepin-4-one?
The InChIKey is OHULKJBAQAYUFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrN2O/c1-13-6-5-9(14)12-10-7(11)3-2-4-8(10)13/h2-4H,5-6H2,1H3,(H,12,14).
What are the key properties of 6-bromo-1-methyl-3,5-dihydro-2H-1,5-benzodiazepin-4-one?
6-bromo-1-methyl-3,5-dihydro-2H-1,5-benzodiazepin-4-one has a molecular weight of 255.11 g/mol, XLogP of 2.23, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-1-methyl-3,5-dihydro-2H-1,5-benzodiazepin-4-one is sourced from PubChem (CID 115098413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).