C11H11BrN2O2 — CID 76907862
1-[(2-bromophenyl)methyl]-1,3-diazinane-2,4-dione (PubChem CID 76907862) has the molecular formula C11H11BrN2O2 and a molecular weight of 283.12 g/mol. Its IUPAC name is 1-[(2-bromophenyl)methyl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[(2-bromophenyl)methyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 76907862 |
| Molecular Formula | C11H11BrN2O2 |
| Molecular Weight | 283.12 g/mol |
| Exact Mass | 282.00 |
| IUPAC Name | 1-[(2-bromophenyl)methyl]-1,3-diazinane-2,4-dione |
| SMILES | O=C1CCN(Cc2ccccc2Br)C(=O)N1 |
| InChI | InChI=1S/C11H11BrN2O2/c12-9-4-2-1-3-8(9)7-14-6-5-10(15)13-11(14)16/h1-4H,5-7H2,(H,13,15,16) |
| InChIKey | FGZUEAIXHKLWFW-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.12 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |