C10H13BrN2 — CID 115094968
5-bromo-4-ethyl-2,3-dihydro-1H-quinoxaline (PubChem CID 115094968) has the molecular formula C10H13BrN2 and a molecular weight of 241.13 g/mol. Its IUPAC name is 5-bromo-4-ethyl-2,3-dihydro-1H-quinoxaline.
| Compound Name | 5-bromo-4-ethyl-2,3-dihydro-1H-quinoxaline |
|---|---|
| PubChem CID | 115094968 |
| Molecular Formula | C10H13BrN2 |
| Molecular Weight | 241.13 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | 5-bromo-4-ethyl-2,3-dihydro-1H-quinoxaline |
| SMILES | CCN1CCNc2cccc(Br)c21 |
| InChI | InChI=1S/C10H13BrN2/c1-2-13-7-6-12-9-5-3-4-8(11)10(9)13/h3-5,12H,2,6-7H2,1H3 |
| InChIKey | UIVZBYYPHKUOCM-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.13 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |