C11H16N2O — CID 115095768
(1-ethyl-3,4-dihydro-2H-quinoxalin-5-yl)methanol (PubChem CID 115095768) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is (1-ethyl-3,4-dihydro-2H-quinoxalin-5-yl)methanol.
| Compound Name | (1-ethyl-3,4-dihydro-2H-quinoxalin-5-yl)methanol |
|---|---|
| PubChem CID | 115095768 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | (1-ethyl-3,4-dihydro-2H-quinoxalin-5-yl)methanol |
| SMILES | CCN1CCNc2c(CO)cccc21 |
| InChI | InChI=1S/C11H16N2O/c1-2-13-7-6-12-11-9(8-14)4-3-5-10(11)13/h3-5,12,14H,2,6-8H2,1H3 |
| InChIKey | CTURZRFVXRJSEW-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |