About (1-ethyl-2-methyl-3,4-dihydro-2H-quinoxalin-5-yl)methanol
(1-ethyl-2-methyl-3,4-dihydro-2H-quinoxalin-5-yl)methanol (PubChem CID 115096618) has the molecular formula C12H18N2O
and a molecular weight of 206.29 g/mol. Its IUPAC name is (1-ethyl-2-methyl-3,4-dihydro-2H-quinoxalin-5-yl)methanol.
Molecular Properties
| Compound Name | (1-ethyl-2-methyl-3,4-dihydro-2H-quinoxalin-5-yl)methanol |
| PubChem CID | 115096618 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | (1-ethyl-2-methyl-3,4-dihydro-2H-quinoxalin-5-yl)methanol |
| SMILES | CCN1c2cccc(CO)c2NCC1C |
| InChI | InChI=1S/C12H18N2O/c1-3-14-9(2)7-13-12-10(8-15)5-4-6-11(12)14/h4-6,9,13,15H,3,7-8H2,1-2H3 |
| InChIKey | RBSMNVLIUHYDAO-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1-ethyl-2-methyl-3,4-dihydro-2H-quinoxalin-5-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethyl-2-methyl-3,4-dihydro-2H-quinoxalin-5-yl)methanol?
The IUPAC name of (1-ethyl-2-methyl-3,4-dihydro-2H-quinoxalin-5-yl)methanol (CID 115096618) is (1-ethyl-2-methyl-3,4-dihydro-2H-quinoxalin-5-yl)methanol.
What is the SMILES notation for (1-ethyl-2-methyl-3,4-dihydro-2H-quinoxalin-5-yl)methanol?
The canonical SMILES for (1-ethyl-2-methyl-3,4-dihydro-2H-quinoxalin-5-yl)methanol is CCN1c2cccc(CO)c2NCC1C.
What is the InChIKey of (1-ethyl-2-methyl-3,4-dihydro-2H-quinoxalin-5-yl)methanol?
The InChIKey is RBSMNVLIUHYDAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O/c1-3-14-9(2)7-13-12-10(8-15)5-4-6-11(12)14/h4-6,9,13,15H,3,7-8H2,1-2H3.
What are the key properties of (1-ethyl-2-methyl-3,4-dihydro-2H-quinoxalin-5-yl)methanol?
(1-ethyl-2-methyl-3,4-dihydro-2H-quinoxalin-5-yl)methanol has a molecular weight of 206.29 g/mol, XLogP of 1.82, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethyl-2-methyl-3,4-dihydro-2H-quinoxalin-5-yl)methanol is sourced from PubChem (CID 115096618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).