C11H15BrN2 — CID 115095634
7-bromo-4-ethyl-3-methyl-2,3-dihydro-1H-quinoxaline (PubChem CID 115095634) has the molecular formula C11H15BrN2 and a molecular weight of 255.16 g/mol. Its IUPAC name is 7-bromo-4-ethyl-3-methyl-2,3-dihydro-1H-quinoxaline.
| Compound Name | 7-bromo-4-ethyl-3-methyl-2,3-dihydro-1H-quinoxaline |
|---|---|
| PubChem CID | 115095634 |
| Molecular Formula | C11H15BrN2 |
| Molecular Weight | 255.16 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 7-bromo-4-ethyl-3-methyl-2,3-dihydro-1H-quinoxaline |
| SMILES | CCN1c2ccc(Br)cc2NCC1C |
| InChI | InChI=1S/C11H15BrN2/c1-3-14-8(2)7-13-10-6-9(12)4-5-11(10)14/h4-6,8,13H,3,7H2,1-2H3 |
| InChIKey | WICRFNDOQJTGMM-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.16 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |