About 7-bromo-1-methyl-3,4-dihydro-2H-pyrido[2,3-b]pyrazine
7-bromo-1-methyl-3,4-dihydro-2H-pyrido[2,3-b]pyrazine (PubChem CID 84691711) has the molecular formula C8H10BrN3
and a molecular weight of 228.09 g/mol. Its IUPAC name is 7-bromo-1-methyl-3,4-dihydro-2H-pyrido[2,3-b]pyrazine.
Analyze 7-bromo-1-methyl-3,4-dihydro-2H-pyrido[2,3-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-1-methyl-3,4-dihydro-2H-pyrido[2,3-b]pyrazine?
The IUPAC name of 7-bromo-1-methyl-3,4-dihydro-2H-pyrido[2,3-b]pyrazine (CID 84691711) is 7-bromo-1-methyl-3,4-dihydro-2H-pyrido[2,3-b]pyrazine.
What is the SMILES notation for 7-bromo-1-methyl-3,4-dihydro-2H-pyrido[2,3-b]pyrazine?
The canonical SMILES for 7-bromo-1-methyl-3,4-dihydro-2H-pyrido[2,3-b]pyrazine is CN1CCNc2ncc(Br)cc21.
What is the InChIKey of 7-bromo-1-methyl-3,4-dihydro-2H-pyrido[2,3-b]pyrazine?
The InChIKey is ZKTUOAOQCBTIMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10BrN3/c1-12-3-2-10-8-7(12)4-6(9)5-11-8/h4-5H,2-3H2,1H3,(H,10,11).
What are the key properties of 7-bromo-1-methyl-3,4-dihydro-2H-pyrido[2,3-b]pyrazine?
7-bromo-1-methyl-3,4-dihydro-2H-pyrido[2,3-b]pyrazine has a molecular weight of 228.09 g/mol, XLogP of 1.71, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-1-methyl-3,4-dihydro-2H-pyrido[2,3-b]pyrazine is sourced from PubChem (CID 84691711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).