C14H20N2 — CID 105470427
4-cyclohexyl-2,3-dihydro-1H-quinoxaline (PubChem CID 105470427) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 4-cyclohexyl-2,3-dihydro-1H-quinoxaline.
| Compound Name | 4-cyclohexyl-2,3-dihydro-1H-quinoxaline |
|---|---|
| PubChem CID | 105470427 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 4-cyclohexyl-2,3-dihydro-1H-quinoxaline |
| SMILES | c1ccc2c(c1)NCCN2C1CCCCC1 |
| InChI | InChI=1S/C14H20N2/c1-2-6-12(7-3-1)16-11-10-15-13-8-4-5-9-14(13)16/h4-5,8-9,12,15H,1-3,6-7,10-11H2 |
| InChIKey | VTWRMTSGOAHZPJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |