C13H19N3 — CID 117030821
4-piperidin-3-yl-2,3-dihydro-1H-quinoxaline (PubChem CID 117030821) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is 4-piperidin-3-yl-2,3-dihydro-1H-quinoxaline.
| Compound Name | 4-piperidin-3-yl-2,3-dihydro-1H-quinoxaline |
|---|---|
| PubChem CID | 117030821 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 4-piperidin-3-yl-2,3-dihydro-1H-quinoxaline |
| SMILES | c1ccc2c(c1)NCCN2C1CCCNC1 |
| InChI | InChI=1S/C13H19N3/c1-2-6-13-12(5-1)15-8-9-16(13)11-4-3-7-14-10-11/h1-2,5-6,11,14-15H,3-4,7-10H2 |
| InChIKey | QUMMMDHJHOBZKX-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |