C12H16N2 — CID 82404880
(3aS)-7-methyl-1,2,3,3a,4,5-hexahydropyrrolo[1,2-a]quinoxaline (PubChem CID 82404880) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is (3aS)-7-methyl-1,2,3,3a,4,5-hexahydropyrrolo[1,2-a]quinoxaline.
| Compound Name | (3aS)-7-methyl-1,2,3,3a,4,5-hexahydropyrrolo[1,2-a]quinoxaline |
|---|---|
| PubChem CID | 82404880 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | (3aS)-7-methyl-1,2,3,3a,4,5-hexahydropyrrolo[1,2-a]quinoxaline |
| SMILES | Cc1ccc2c(c1)NC[C@@H]1CCCN21 |
| InChI | InChI=1S/C12H16N2/c1-9-4-5-12-11(7-9)13-8-10-3-2-6-14(10)12/h4-5,7,10,13H,2-3,6,8H2,1H3/t10-/m0/s1 |
| InChIKey | CWDBZXIJRYRJPQ-JTQLQIEISA-N |
| XLogP | 2.39 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |