C15H22N2 — CID 84626454
8-tert-butyl-1,2,3,3a,4,5-hexahydropyrrolo[1,2-a]quinoxaline (PubChem CID 84626454) has the molecular formula C15H22N2 and a molecular weight of 230.36 g/mol. Its IUPAC name is 8-tert-butyl-1,2,3,3a,4,5-hexahydropyrrolo[1,2-a]quinoxaline.
| Compound Name | 8-tert-butyl-1,2,3,3a,4,5-hexahydropyrrolo[1,2-a]quinoxaline |
|---|---|
| PubChem CID | 84626454 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 8-tert-butyl-1,2,3,3a,4,5-hexahydropyrrolo[1,2-a]quinoxaline |
| SMILES | CC(C)(C)c1ccc2c(c1)N1CCCC1CN2 |
| InChI | InChI=1S/C15H22N2/c1-15(2,3)11-6-7-13-14(9-11)17-8-4-5-12(17)10-16-13/h6-7,9,12,16H,4-5,8,10H2,1-3H3 |
| InChIKey | PYRWMPAUTPLKLD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |