C18H30N6O3 — CID 71124222
(5S,13S,21S)-1,3,9,11,17,19-hexazatetracyclo[19.3.0.05,9.013,17]tetracosane-2,10,18-trione (PubChem CID 71124222) has the molecular formula C18H30N6O3 and a molecular weight of 378.48 g/mol. Its IUPAC name is (5S,13S,21S)-1,3,9,11,17,19-hexazatetracyclo[19.3.0.05,9.013,17]tetracosane-2,10,18-trione.
| Compound Name | (5S,13S,21S)-1,3,9,11,17,19-hexazatetracyclo[19.3.0.05,9.013,17]tetracosane-2,10,18-trione |
|---|---|
| PubChem CID | 71124222 |
| Molecular Formula | C18H30N6O3 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | (5S,13S,21S)-1,3,9,11,17,19-hexazatetracyclo[19.3.0.05,9.013,17]tetracosane-2,10,18-trione |
| SMILES | O=C1NC[C@@H]2CCCN2C(=O)NC[C@@H]2CCCN2C(=O)NC[C@@H]2CCCN12 |
| InChI | InChI=1S/C18H30N6O3/c25-16-20-11-14-5-2-9-24(14)18(27)21-12-15-6-3-8-23(15)17(26)19-10-13-4-1-7-22(13)16/h13-15H,1-12H2,(H,19,26)(H,20,25)(H,21,27)/t13-,14-,15-/m0/s1 |
| InChIKey | VNZAICYKALDIBR-KKUMJFAQSA-N |
| XLogP | 0.52 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |