C9H18ClN3O — CID 162422983
1-[(3R)-piperidin-3-yl]-1,3-diazinan-2-one;hydrochloride (PubChem CID 162422983) has the molecular formula C9H18ClN3O and a molecular weight of 219.72 g/mol. Its IUPAC name is 1-[(3R)-piperidin-3-yl]-1,3-diazinan-2-one;hydrochloride.
| Compound Name | 1-[(3R)-piperidin-3-yl]-1,3-diazinan-2-one;hydrochloride |
|---|---|
| PubChem CID | 162422983 |
| Molecular Formula | C9H18ClN3O |
| Molecular Weight | 219.72 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 1-[(3R)-piperidin-3-yl]-1,3-diazinan-2-one;hydrochloride |
| SMILES | Cl.O=C1NCCCN1[C@@H]1CCCNC1 |
| InChI | InChI=1S/C9H17N3O.ClH/c13-9-11-5-2-6-12(9)8-3-1-4-10-7-8;/h8,10H,1-7H2,(H,11,13);1H/t8-;/m1./s1 |
| InChIKey | LTJJYZJPQYFAIA-DDWIOCJRSA-N |
| XLogP | 0.58 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.72 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |