C11H19N3O — CID 115371023
1-(1-cyclopropylpyrrolidin-3-yl)-1,3-diazinan-2-one (PubChem CID 115371023) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 1-(1-cyclopropylpyrrolidin-3-yl)-1,3-diazinan-2-one.
| Compound Name | 1-(1-cyclopropylpyrrolidin-3-yl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 115371023 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 1-(1-cyclopropylpyrrolidin-3-yl)-1,3-diazinan-2-one |
| SMILES | O=C1NCCCN1C1CCN(C2CC2)C1 |
| InChI | InChI=1S/C11H19N3O/c15-11-12-5-1-6-14(11)10-4-7-13(8-10)9-2-3-9/h9-10H,1-8H2,(H,12,15) |
| InChIKey | FHLAZDIVYICTQZ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |