C16H21N3O2 — CID 134793694
1-(1-benzoylpiperidin-4-yl)-1,3-diazinan-2-one (PubChem CID 134793694) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 1-(1-benzoylpiperidin-4-yl)-1,3-diazinan-2-one.
| Compound Name | 1-(1-benzoylpiperidin-4-yl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 134793694 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 1-(1-benzoylpiperidin-4-yl)-1,3-diazinan-2-one |
| SMILES | O=C(c1ccccc1)N1CCC(N2CCCNC2=O)CC1 |
| InChI | InChI=1S/C16H21N3O2/c20-15(13-5-2-1-3-6-13)18-11-7-14(8-12-18)19-10-4-9-17-16(19)21/h1-3,5-6,14H,4,7-12H2,(H,17,21) |
| InChIKey | MZIJJTSDZIRTET-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |