C17H23N3O3 — CID 134794616
1-[1-(3-methoxybenzoyl)piperidin-4-yl]-1,3-diazinan-2-one (PubChem CID 134794616) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is 1-[1-(3-methoxybenzoyl)piperidin-4-yl]-1,3-diazinan-2-one.
| Compound Name | 1-[1-(3-methoxybenzoyl)piperidin-4-yl]-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 134794616 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 1-[1-(3-methoxybenzoyl)piperidin-4-yl]-1,3-diazinan-2-one |
| SMILES | COc1cccc(C(=O)N2CCC(N3CCCNC3=O)CC2)c1 |
| InChI | InChI=1S/C17H23N3O3/c1-23-15-5-2-4-13(12-15)16(21)19-10-6-14(7-11-19)20-9-3-8-18-17(20)22/h2,4-5,12,14H,3,6-11H2,1H3,(H,18,22) |
| InChIKey | RJMSUOYIJXJJCO-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |