C17H21N5O2 — CID 71912055
1-[1-(1H-indazole-3-carbonyl)piperidin-4-yl]-1,3-diazinan-2-one (PubChem CID 71912055) has the molecular formula C17H21N5O2 and a molecular weight of 327.39 g/mol. Its IUPAC name is 1-[1-(1H-indazole-3-carbonyl)piperidin-4-yl]-1,3-diazinan-2-one.
| Compound Name | 1-[1-(1H-indazole-3-carbonyl)piperidin-4-yl]-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 71912055 |
| Molecular Formula | C17H21N5O2 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | 1-[1-(1H-indazole-3-carbonyl)piperidin-4-yl]-1,3-diazinan-2-one |
| SMILES | O=C(c1n[nH]c2ccccc12)N1CCC(N2CCCNC2=O)CC1 |
| InChI | InChI=1S/C17H21N5O2/c23-16(15-13-4-1-2-5-14(13)19-20-15)21-10-6-12(7-11-21)22-9-3-8-18-17(22)24/h1-2,4-5,12H,3,6-11H2,(H,18,24)(H,19,20) |
| InChIKey | UIHHZSAOYUKIRJ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 81.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |