C18H21N3O2S — CID 136516942
1-[1-(1-benzothiophene-5-carbonyl)piperidin-4-yl]-1,3-diazinan-2-one (PubChem CID 136516942) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is 1-[1-(1-benzothiophene-5-carbonyl)piperidin-4-yl]-1,3-diazinan-2-one.
| Compound Name | 1-[1-(1-benzothiophene-5-carbonyl)piperidin-4-yl]-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 136516942 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 1-[1-(1-benzothiophene-5-carbonyl)piperidin-4-yl]-1,3-diazinan-2-one |
| SMILES | O=C(c1ccc2sccc2c1)N1CCC(N2CCCNC2=O)CC1 |
| InChI | InChI=1S/C18H21N3O2S/c22-17(14-2-3-16-13(12-14)6-11-24-16)20-9-4-15(5-10-20)21-8-1-7-19-18(21)23/h2-3,6,11-12,15H,1,4-5,7-10H2,(H,19,23) |
| InChIKey | KHICOUIHTSIFJY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |