C17H22N2O2S — CID 119662741
[4-(3-aminopropoxy)piperidin-1-yl]-(1-benzothiophen-5-yl)methanone (PubChem CID 119662741) has the molecular formula C17H22N2O2S and a molecular weight of 318.44 g/mol. Its IUPAC name is [4-(3-aminopropoxy)piperidin-1-yl]-(1-benzothiophen-5-yl)methanone.
| Compound Name | [4-(3-aminopropoxy)piperidin-1-yl]-(1-benzothiophen-5-yl)methanone |
|---|---|
| PubChem CID | 119662741 |
| Molecular Formula | C17H22N2O2S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | [4-(3-aminopropoxy)piperidin-1-yl]-(1-benzothiophen-5-yl)methanone |
| SMILES | NCCCOC1CCN(C(=O)c2ccc3sccc3c2)CC1 |
| InChI | InChI=1S/C17H22N2O2S/c18-7-1-10-21-15-4-8-19(9-5-15)17(20)14-2-3-16-13(12-14)6-11-22-16/h2-3,6,11-12,15H,1,4-5,7-10,18H2 |
| InChIKey | UXMAXEVXLBIJAD-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|