C22H38Cl2N4O2 — CID 119664634
[4-(3-aminopropoxy)piperidin-1-yl]-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]methanone;dihydrochloride (PubChem CID 119664634) has the molecular formula C22H38Cl2N4O2 and a molecular weight of 461.48 g/mol. Its IUPAC name is [4-(3-aminopropoxy)piperidin-1-yl]-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]methanone;dihydrochloride.
| Compound Name | [4-(3-aminopropoxy)piperidin-1-yl]-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 119664634 |
| Molecular Formula | C22H38Cl2N4O2 |
| Molecular Weight | 461.48 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | [4-(3-aminopropoxy)piperidin-1-yl]-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]methanone;dihydrochloride |
| SMILES | CC(C)N1CCN(c2ccc(C(=O)N3CCC(OCCCN)CC3)cc2)CC1.Cl.Cl |
| InChI | InChI=1S/C22H36N4O2.2ClH/c1-18(2)24-13-15-25(16-14-24)20-6-4-19(5-7-20)22(27)26-11-8-21(9-12-26)28-17-3-10-23;;/h4-7,18,21H,3,8-17,23H2,1-2H3;2*1H |
| InChIKey | KZNGZCGGONQPJQ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 62.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.48 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|