C18H25ClN4O2 — CID 119662498
[4-(3-aminopropoxy)piperidin-1-yl]-(4-pyrazol-1-ylphenyl)methanone;hydrochloride (PubChem CID 119662498) has the molecular formula C18H25ClN4O2 and a molecular weight of 364.88 g/mol. Its IUPAC name is [4-(3-aminopropoxy)piperidin-1-yl]-(4-pyrazol-1-ylphenyl)methanone;hydrochloride.
| Compound Name | [4-(3-aminopropoxy)piperidin-1-yl]-(4-pyrazol-1-ylphenyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119662498 |
| Molecular Formula | C18H25ClN4O2 |
| Molecular Weight | 364.88 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | [4-(3-aminopropoxy)piperidin-1-yl]-(4-pyrazol-1-ylphenyl)methanone;hydrochloride |
| SMILES | Cl.NCCCOC1CCN(C(=O)c2ccc(-n3cccn3)cc2)CC1 |
| InChI | InChI=1S/C18H24N4O2.ClH/c19-9-1-14-24-17-7-12-21(13-8-17)18(23)15-3-5-16(6-4-15)22-11-2-10-20-22;/h2-6,10-11,17H,1,7-9,12-14,19H2;1H |
| InChIKey | AEGFWHLJYYHAFX-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.88 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|