C18H25ClN4O3 — CID 119661589
[4-(3-aminopropoxy)piperidin-1-yl]-(4-hydroxy-1-phenylpyrazol-3-yl)methanone;hydrochloride (PubChem CID 119661589) has the molecular formula C18H25ClN4O3 and a molecular weight of 380.88 g/mol. Its IUPAC name is [4-(3-aminopropoxy)piperidin-1-yl]-(4-hydroxy-1-phenylpyrazol-3-yl)methanone;hydrochloride.
| Compound Name | [4-(3-aminopropoxy)piperidin-1-yl]-(4-hydroxy-1-phenylpyrazol-3-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119661589 |
| Molecular Formula | C18H25ClN4O3 |
| Molecular Weight | 380.88 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | [4-(3-aminopropoxy)piperidin-1-yl]-(4-hydroxy-1-phenylpyrazol-3-yl)methanone;hydrochloride |
| SMILES | Cl.NCCCOC1CCN(C(=O)c2nn(-c3ccccc3)cc2O)CC1 |
| InChI | InChI=1S/C18H24N4O3.ClH/c19-9-4-12-25-15-7-10-21(11-8-15)18(24)17-16(23)13-22(20-17)14-5-2-1-3-6-14;/h1-3,5-6,13,15,23H,4,7-12,19H2;1H |
| InChIKey | DMNRJTDBFNAHHC-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.88 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|