C18H27ClN2O2 — CID 119661960
[4-(3-aminopropoxy)piperidin-1-yl]-(1-phenylcyclopropyl)methanone;hydrochloride (PubChem CID 119661960) has the molecular formula C18H27ClN2O2 and a molecular weight of 338.88 g/mol. Its IUPAC name is [4-(3-aminopropoxy)piperidin-1-yl]-(1-phenylcyclopropyl)methanone;hydrochloride.
| Compound Name | [4-(3-aminopropoxy)piperidin-1-yl]-(1-phenylcyclopropyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119661960 |
| Molecular Formula | C18H27ClN2O2 |
| Molecular Weight | 338.88 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | [4-(3-aminopropoxy)piperidin-1-yl]-(1-phenylcyclopropyl)methanone;hydrochloride |
| SMILES | Cl.NCCCOC1CCN(C(=O)C2(c3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C18H26N2O2.ClH/c19-11-4-14-22-16-7-12-20(13-8-16)17(21)18(9-10-18)15-5-2-1-3-6-15;/h1-3,5-6,16H,4,7-14,19H2;1H |
| InChIKey | RFOXBLFQUOYAMX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.88 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|