C22H32N2O4 — CID 146076167
[4-(3-aminopropoxy)piperidin-1-yl]-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopentyl]methanone (PubChem CID 146076167) has the molecular formula C22H32N2O4 and a molecular weight of 388.51 g/mol. Its IUPAC name is [4-(3-aminopropoxy)piperidin-1-yl]-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopentyl]methanone.
| Compound Name | [4-(3-aminopropoxy)piperidin-1-yl]-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopentyl]methanone |
|---|---|
| PubChem CID | 146076167 |
| Molecular Formula | C22H32N2O4 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | [4-(3-aminopropoxy)piperidin-1-yl]-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopentyl]methanone |
| SMILES | NCCCOC1CCN(C(=O)C2(c3ccc4c(c3)OCCO4)CCCC2)CC1 |
| InChI | InChI=1S/C22H32N2O4/c23-10-3-13-26-18-6-11-24(12-7-18)21(25)22(8-1-2-9-22)17-4-5-19-20(16-17)28-15-14-27-19/h4-5,16,18H,1-3,6-15,23H2 |
| InChIKey | FTJWHXMMLOGWHK-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|