C17H24BrClN2O4 — CID 119661780
[4-(3-aminopropoxy)piperidin-1-yl]-(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methanone;hydrochloride (PubChem CID 119661780) has the molecular formula C17H24BrClN2O4 and a molecular weight of 435.75 g/mol. Its IUPAC name is [4-(3-aminopropoxy)piperidin-1-yl]-(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methanone;hydrochloride.
| Compound Name | [4-(3-aminopropoxy)piperidin-1-yl]-(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119661780 |
| Molecular Formula | C17H24BrClN2O4 |
| Molecular Weight | 435.75 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | [4-(3-aminopropoxy)piperidin-1-yl]-(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methanone;hydrochloride |
| SMILES | Cl.NCCCOC1CCN(C(=O)c2cc(Br)c3c(c2)OCCO3)CC1 |
| InChI | InChI=1S/C17H23BrN2O4.ClH/c18-14-10-12(11-15-16(14)24-9-8-23-15)17(21)20-5-2-13(3-6-20)22-7-1-4-19;/h10-11,13H,1-9,19H2;1H |
| InChIKey | HZJNACKTCDYSMQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.75 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|