C20H30ClFN2O3 — CID 119662597
[4-(3-aminopropoxy)piperidin-1-yl]-[4-(3-fluorophenyl)oxan-4-yl]methanone;hydrochloride (PubChem CID 119662597) has the molecular formula C20H30ClFN2O3 and a molecular weight of 400.92 g/mol. Its IUPAC name is [4-(3-aminopropoxy)piperidin-1-yl]-[4-(3-fluorophenyl)oxan-4-yl]methanone;hydrochloride.
| Compound Name | [4-(3-aminopropoxy)piperidin-1-yl]-[4-(3-fluorophenyl)oxan-4-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119662597 |
| Molecular Formula | C20H30ClFN2O3 |
| Molecular Weight | 400.92 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | [4-(3-aminopropoxy)piperidin-1-yl]-[4-(3-fluorophenyl)oxan-4-yl]methanone;hydrochloride |
| SMILES | Cl.NCCCOC1CCN(C(=O)C2(c3cccc(F)c3)CCOCC2)CC1 |
| InChI | InChI=1S/C20H29FN2O3.ClH/c21-17-4-1-3-16(15-17)20(7-13-25-14-8-20)19(24)23-10-5-18(6-11-23)26-12-2-9-22;/h1,3-4,15,18H,2,5-14,22H2;1H |
| InChIKey | NDFLGWOLUFWXJQ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.92 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|