C14H17ClN4O — CID 119401221
piperazin-1-yl-(4-pyrazol-1-ylphenyl)methanone;hydrochloride (PubChem CID 119401221) has the molecular formula C14H17ClN4O and a molecular weight of 292.77 g/mol. Its IUPAC name is piperazin-1-yl-(4-pyrazol-1-ylphenyl)methanone;hydrochloride.
| Compound Name | piperazin-1-yl-(4-pyrazol-1-ylphenyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119401221 |
| Molecular Formula | C14H17ClN4O |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | piperazin-1-yl-(4-pyrazol-1-ylphenyl)methanone;hydrochloride |
| SMILES | Cl.O=C(c1ccc(-n2cccn2)cc1)N1CCNCC1 |
| InChI | InChI=1S/C14H16N4O.ClH/c19-14(17-10-7-15-8-11-17)12-2-4-13(5-3-12)18-9-1-6-16-18;/h1-6,9,15H,7-8,10-11H2;1H |
| InChIKey | WUXDCVASJCGHIW-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |